A) 0.014g B) 14.28g/cm3 C) 14,000 g/cm3 D) 0.014 g/cm3
A) very close together and freely moving B) very far apart and feely moving C) somewhat spread apart with almost not movement D) somewhat spread apart with little movement
A) atom with different number of protons B) atom with different number of energy levels C) atom with different number of electrons D) atom with different number of neutrons
A) 4p B) 3d C) 5s D) 4d
A) S B) Na C) Si
A) magnesium B) oxygen C) aluminum D) nitrogen
A) 2.05x1024atoms B) 0.56x10-24atoms C) 2.05atoms D) 18.3atoms
A) 36.4x1023 mol B) 0.37mol C) 2.70mol D) 185.92mol
A) 0.041grams B) 24.67grams C) 117grams D) 222grams
A) AlCl2 B) AlCl3 C) Al2Cl3 D) Al2Cl
A) combustion B) decomposition C) single-replacement D) composition
A) double-replacement B) composition C) single-replacement D) combustion
A) __,3,__,3 B) balanced C) __,3,3,__ D) 3,__,__,3
A) subscripts B) products C) coefficients D) reactants
A) 52.0grams B) 138.7grams C) 39.6grams D) 65.6grams
A) Li=+1 O=-2 B) Li=+2 O=-2 C) Li=+1 O=-1 D) Li=+2 O=-1
A) 120 g/mol B) 120 amu C) 76 amu D) 76 g/mol
A) 89% B) 20% C) 11% D) 2%
A) 36 amu B) 74 amu C) 74 g/mol D) 36 g/mol
A) combustion B) synthesis C) double-displacement D) single-displacement E) decomposition
A) synthesis B) combustion C) single-displacement D) double-displacement E) decompostion
A) synthesis B) double-displacement C) single-displacement D) combustion E) decompostion
A) combustion B) synthesis C) single-displacement D) decomposition E) double-displacement
A) combustion B) single-displacement C) synthesis D) double-displacement E) decomposition
A) L B) oC C) K D) atm
A) K B) L C) torr D) atm
A) 13976cm3 B) 395cm3 C) 0.001cm3 D) 0.047cm3
A) 706mmHg B) 1200mmHg C) 805mmHg D) 1071mmHg
A) 855K B) 581K C) 105.3K D) 303K
A) 352K B) 421K C) 206K D) 500K
A) 32atm B) 15atm C) 49atm D) 18.9atm
A) Subtract 273 B) Divide by 273 C) Multiply by 273 D) Add 273
A) All of these B) 760 torr C) 101.325kPa D) 1atm
A) L B) Two of the above C) oC D) K
A) research B) communicating results C) organizing data D) experimentation
A) growth B) water C) music D) sunlight
A) music B) sunlight C) water D) growth
A) 86000 B) 8.6 C) 860 D) 0.86
A) element B) homegeneous mixture C) compound D) heterogeneous mixture
A) two of these B) air C) hydrogen D) salt water
A) none of these B) maintain seperate identities C) combine to form new substances D) are hard to pick out
A) chemical property B) physical property
A) physical property B) chemical property
A) chemical change B) physical change
A) chemical change B) physical change
A) transition metals B) halogens C) alkali metals D) noble gases
A) by atomic mass B) by date of discovery C) by atomic number D) alphabetically
A) Millikan B) Thomson C) Rutherford
A) Rutherford B) Millikan C) Thomson
A) 9 B) 8 C) 7 D) 6
A) Not enough information B) it depends on the mass C) 6.02x1023
A) 1s12s22p5 B) 1s22s22p5 C) 1s22s22p6 D) 1s12s12p6
A) [Ar]5s2 B) [Ar] 4s2 C) [Kr]1s22s22p63s23p64s23d104p65s2 D) [Kr]5s2
A) increases B) decreases
A) decreases B) increases
A) 12 B) 6 C) 3 D) 4
A) metallic B) special C) ionic D) covalent
A) covalent B) special C) ionic D) metallic
A) MgS4 B) MgS2 C) MgS D) Mg2S
A) CCl2 B) CCl3 C) CCl4 D) CCl
A) iron (IV) chloride B) iron chloride C) iron (II) chloride D) iron dichloride
A) nitrogen chloride B) nitrogen (III)chloride C) trinitrogen hexachloride D) nitrogen hexachloride
A) shares electrons B) donates/accepts electrons
A) number of atoms B) how much it weighs C) nothing D) charge
A) transition metals B) two of these C) 4A D) groups 1A,2A,3A and 4A
A) __,__,__,__ B) __,3,3,__ C) 3,__,__,3 D) __,3,__,3
A) 2,__,2,__ B) __2,2,__ C) __,2,__,2 D) __,__,__,__
A) dividers B) coefficients C) subscripts D) multipliers
A) nonmetals B) metalloids C) metals
A) valence electrons B) total electrons C) total neutrons D) total protons
A) Cr2Cl2 B) Cr2Cl C) CrCl2 D) CrCl
A) NaCl B) NaOH C) HF D) HCl
A) 25 B) 0g C) 50 D) 12.5g
A) neutral B) acids C) bases
A) ... B) ... C) Ms. Watson |